C17H11Br3O2S — CID 15924332
2,3-dibromo-4-[[4-(3-bromophenoxy)phenoxy]methyl]thiophene (PubChem CID 15924332) has the molecular formula C17H11Br3O2S and a molecular weight of 519.05 g/mol. Its IUPAC name is 2,3-dibromo-4-[[4-(3-bromophenoxy)phenoxy]methyl]thiophene.
| Compound Name | 2,3-dibromo-4-[[4-(3-bromophenoxy)phenoxy]methyl]thiophene |
|---|---|
| PubChem CID | 15924332 |
| Molecular Formula | C17H11Br3O2S |
| Molecular Weight | 519.05 g/mol |
| Exact Mass | 515.80 |
| IUPAC Name | 2,3-dibromo-4-[[4-(3-bromophenoxy)phenoxy]methyl]thiophene |
| SMILES | Brc1cccc(Oc2ccc(OCc3csc(Br)c3Br)cc2)c1 |
| InChI | InChI=1S/C17H11Br3O2S/c18-12-2-1-3-15(8-12)22-14-6-4-13(5-7-14)21-9-11-10-23-17(20)16(11)19/h1-8,10H,9H2 |
| InChIKey | NJSAYMRUBWJASJ-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.05 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |