C33H35FN4O — CID 159243322
4-[3-[[4-[(S)-(3-fluorophenyl)-isocyano-[(1S,2R)-2-(2-oxobut-3-ynyl)cyclopentyl]methyl]piperidin-1-yl]methyl]azetidin-1-yl]benzonitrile (PubChem CID 159243322) has the molecular formula C33H35FN4O and a molecular weight of 522.67 g/mol. Its IUPAC name is 4-[3-[[4-[(S)-(3-fluorophenyl)-isocyano-[(1S,2R)-2-(2-oxobut-3-ynyl)cyclopentyl]methyl]piperidin-1-yl]methyl]azetidin-1-yl]benzonitrile.
| Compound Name | 4-[3-[[4-[(S)-(3-fluorophenyl)-isocyano-[(1S,2R)-2-(2-oxobut-3-ynyl)cyclopentyl]methyl]piperidin-1-yl]methyl]azetidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 159243322 |
| Molecular Formula | C33H35FN4O |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | 4-[3-[[4-[(S)-(3-fluorophenyl)-isocyano-[(1S,2R)-2-(2-oxobut-3-ynyl)cyclopentyl]methyl]piperidin-1-yl]methyl]azetidin-1-yl]benzonitrile |
| SMILES | [C-]#[N+][C@@](c1cccc(F)c1)(C1CCN(CC2CN(c3ccc(C#N)cc3)C2)CC1)[C@H]1CCC[C@@H]1CC(=O)C#C |
| InChI | InChI=1S/C33H35FN4O/c1-3-31(39)18-26-6-4-9-32(26)33(36-2,28-7-5-8-29(34)19-28)27-14-16-37(17-15-27)21-25-22-38(23-25)30-12-10-24(20-35)11-13-30/h1,5,7-8,10-13,19,25-27,32H,4,6,9,14-18,21-23H2/t26-,32+,33-/m1/s1 |
| InChIKey | KUJDOFQNTRMMRZ-SJHFQCKASA-N |
| XLogP | 5.67 |
| TPSA | 51.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|