About CID 159244008
CID 159244008 (PubChem CID 159244008) has the molecular formula C11H12Al2NO2
and a molecular weight of 244.19 g/mol.
Molecular Properties
| Compound Name | CID 159244008 |
| PubChem CID | 159244008 |
| Molecular Formula | C11H12Al2NO2 |
| Molecular Weight | 244.19 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c2cccc(O[Al]O[AlH2])c2n1 |
| InChI | InChI=1S/C11H11NO.2Al.O.2H/c1-7-6-8(2)12-11-9(7)4-3-5-10(11)13;;;;;/h3-6,13H,1-2H3;;;;;/q;;+1;;;/p-1 |
| InChIKey | JJSXFXLOEUKSMV-UHFFFAOYSA-M |
| XLogP | 1.33 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 159244008 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159244008?
The IUPAC name of CID 159244008 (CID 159244008) is not available.
What is the SMILES notation for CID 159244008?
The canonical SMILES for CID 159244008 is Cc1cc(C)c2cccc(O[Al]O[AlH2])c2n1.
What is the InChIKey of CID 159244008?
The InChIKey is JJSXFXLOEUKSMV-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H11NO.2Al.O.2H/c1-7-6-8(2)12-11-9(7)4-3-5-10(11)13;;;;;/h3-6,13H,1-2H3;;;;;/q;;+1;;;/p-1.
What are the key properties of CID 159244008?
CID 159244008 has a molecular weight of 244.19 g/mol, XLogP of 1.33, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159244008 is sourced from PubChem (CID 159244008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).