C26H21FN2O4 — CID 159244057
(3-fluorophenyl)methyl 2-[3-[3-(2,3-dioxobutyl)phenyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]acetate (PubChem CID 159244057) has the molecular formula C26H21FN2O4 and a molecular weight of 444.46 g/mol. Its IUPAC name is (3-fluorophenyl)methyl 2-[3-[3-(2,3-dioxobutyl)phenyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]acetate.
| Compound Name | (3-fluorophenyl)methyl 2-[3-[3-(2,3-dioxobutyl)phenyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]acetate |
|---|---|
| PubChem CID | 159244057 |
| Molecular Formula | C26H21FN2O4 |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | (3-fluorophenyl)methyl 2-[3-[3-(2,3-dioxobutyl)phenyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]acetate |
| SMILES | CC(=O)C(=O)Cc1cccc(-c2c[nH]c3ncc(CC(=O)OCc4cccc(F)c4)cc23)c1 |
| InChI | InChI=1S/C26H21FN2O4/c1-16(30)24(31)11-17-4-2-6-20(8-17)23-14-29-26-22(23)10-19(13-28-26)12-25(32)33-15-18-5-3-7-21(27)9-18/h2-10,13-14H,11-12,15H2,1H3,(H,28,29) |
| InChIKey | KULLRNGLOXCRRY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|