C14H15BN2O — CID 159244934
CID 159244934 (PubChem CID 159244934) has the molecular formula C14H15BN2O and a molecular weight of 238.10 g/mol.
| Compound Name | CID 159244934 |
|---|---|
| PubChem CID | 159244934 |
| Molecular Formula | C14H15BN2O |
| Molecular Weight | 238.10 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | — |
| SMILES | [B]Cc1ccc2c3c(c(=O)n(C)c2c1)CCCN3 |
| InChI | InChI=1S/C14H15BN2O/c1-17-12-7-9(8-15)4-5-10(12)13-11(14(17)18)3-2-6-16-13/h4-5,7,16H,2-3,6,8H2,1H3 |
| InChIKey | JZMMYGDCCXJVDR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.10 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|