C26H33N7O6 — CID 159247074
ethyl 4-oxo-3,5,6,7,8,9-hexahydropyrimido[4,5-b]indole-6-carboxylate;ethyl 4-[(6-oxo-1H-pyrimidin-4-yl)hydrazinylidene]cyclohexane-1-carboxylate (PubChem CID 159247074) has the molecular formula C26H33N7O6 and a molecular weight of 539.59 g/mol. Its IUPAC name is ethyl 4-oxo-3,5,6,7,8,9-hexahydropyrimido[4,5-b]indole-6-carboxylate;ethyl 4-[(6-oxo-1H-pyrimidin-4-yl)hydrazinylidene]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-oxo-3,5,6,7,8,9-hexahydropyrimido[4,5-b]indole-6-carboxylate;ethyl 4-[(6-oxo-1H-pyrimidin-4-yl)hydrazinylidene]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 159247074 |
| Molecular Formula | C26H33N7O6 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | ethyl 4-oxo-3,5,6,7,8,9-hexahydropyrimido[4,5-b]indole-6-carboxylate;ethyl 4-[(6-oxo-1H-pyrimidin-4-yl)hydrazinylidene]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(=NNc2cc(=O)[nH]cn2)CC1.CCOC(=O)C1CCc2[nH]c3nc[nH]c(=O)c3c2C1 |
| InChI | InChI=1S/C13H18N4O3.C13H15N3O3/c1-2-20-13(19)9-3-5-10(6-4-9)16-17-11-7-12(18)15-8-14-11;1-2-19-13(18)7-3-4-9-8(5-7)10-11(16-9)14-6-15-12(10)17/h7-9H,2-6H2,1H3,(H2,14,15,17,18);6-7H,2-5H2,1H3,(H2,14,15,16,17)/b16-10-; |
| InChIKey | KUUVHGLOTCJXRD-HYMQDMCPSA-N |
| XLogP | 2.21 |
| TPSA | 184.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|