About 4-[(E)-4-deuteriooxybut-2-enoxy]butan-2-one;tritiomethane
4-[(E)-4-deuteriooxybut-2-enoxy]butan-2-one;tritiomethane (PubChem CID 159247174) has the molecular formula C9H18O3
and a molecular weight of 177.25 g/mol. Its IUPAC name is 4-[(E)-4-deuteriooxybut-2-enoxy]butan-2-one;tritiomethane.
Molecular Properties
| Compound Name | 4-[(E)-4-deuteriooxybut-2-enoxy]butan-2-one;tritiomethane |
| PubChem CID | 159247174 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.14 |
| IUPAC Name | 4-[(E)-4-deuteriooxybut-2-enoxy]butan-2-one;tritiomethane |
| SMILES | [2H]OC/C=C/COCCC(C)=O.[3H]C |
| InChI | InChI=1S/C8H14O3.CH4/c1-8(10)4-7-11-6-3-2-5-9;/h2-3,9H,4-7H2,1H3;1H4/b3-2+;/i9D;1T |
| InChIKey | KUVCDLPSLYCAKN-HAQJRPSYSA-N |
| XLogP | 1.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-4-deuteriooxybut-2-enoxy]butan-2-one;tritiomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-4-deuteriooxybut-2-enoxy]butan-2-one;tritiomethane?
The IUPAC name of 4-[(E)-4-deuteriooxybut-2-enoxy]butan-2-one;tritiomethane (CID 159247174) is 4-[(E)-4-deuteriooxybut-2-enoxy]butan-2-one;tritiomethane.
What is the SMILES notation for 4-[(E)-4-deuteriooxybut-2-enoxy]butan-2-one;tritiomethane?
The canonical SMILES for 4-[(E)-4-deuteriooxybut-2-enoxy]butan-2-one;tritiomethane is [2H]OC/C=C/COCCC(C)=O.[3H]C.
What is the InChIKey of 4-[(E)-4-deuteriooxybut-2-enoxy]butan-2-one;tritiomethane?
The InChIKey is KUVCDLPSLYCAKN-HAQJRPSYSA-N. The full InChI is InChI=1S/C8H14O3.CH4/c1-8(10)4-7-11-6-3-2-5-9;/h2-3,9H,4-7H2,1H3;1H4/b3-2+;/i9D;1T.
What are the key properties of 4-[(E)-4-deuteriooxybut-2-enoxy]butan-2-one;tritiomethane?
4-[(E)-4-deuteriooxybut-2-enoxy]butan-2-one;tritiomethane has a molecular weight of 177.25 g/mol, XLogP of 1.17, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-4-deuteriooxybut-2-enoxy]butan-2-one;tritiomethane is sourced from PubChem (CID 159247174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).