C34H41NO9 — CID 159247199
1-O-[(2S,6S)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-phenyl (2R)-2-hydroxy-2-(4-hydroxy-4-methylpentyl)butanedioate (PubChem CID 159247199) has the molecular formula C34H41NO9 and a molecular weight of 607.70 g/mol. Its IUPAC name is 1-O-[(2S,6S)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-phenyl (2R)-2-hydroxy-2-(4-hydroxy-4-methylpentyl)butanedioate.
| Compound Name | 1-O-[(2S,6S)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-phenyl (2R)-2-hydroxy-2-(4-hydroxy-4-methylpentyl)butanedioate |
|---|---|
| PubChem CID | 159247199 |
| Molecular Formula | C34H41NO9 |
| Molecular Weight | 607.70 g/mol |
| Exact Mass | 607.28 |
| IUPAC Name | 1-O-[(2S,6S)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-phenyl (2R)-2-hydroxy-2-(4-hydroxy-4-methylpentyl)butanedioate |
| SMILES | COC1=C[C@@]23CCCN2CCc2cc4c(cc2[C@@H]3C1OC(=O)[C@@](O)(CCCC(C)(C)O)CC(=O)Oc1ccccc1)OCO4 |
| InChI | InChI=1S/C34H41NO9/c1-32(2,38)12-7-14-34(39,20-28(36)43-23-9-5-4-6-10-23)31(37)44-30-27(40-3)19-33-13-8-15-35(33)16-11-22-17-25-26(42-21-41-25)18-24(22)29(30)33/h4-6,9-10,17-19,29-30,38-39H,7-8,11-16,20-21H2,1-3H3/t29-,30?,33-,34-/m1/s1 |
| InChIKey | VNLDRJAEEMJWIM-GHSZIGTMSA-N |
| XLogP | 4.01 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.70 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|