C16H17BrN2O3S — CID 159247234
1-bromobutane;1-(thiophen-3-ylmethyl)pyrido[2,3-d][1,3]oxazine-2,4-dione (PubChem CID 159247234) has the molecular formula C16H17BrN2O3S and a molecular weight of 397.29 g/mol. Its IUPAC name is 1-bromobutane;1-(thiophen-3-ylmethyl)pyrido[2,3-d][1,3]oxazine-2,4-dione.
| Compound Name | 1-bromobutane;1-(thiophen-3-ylmethyl)pyrido[2,3-d][1,3]oxazine-2,4-dione |
|---|---|
| PubChem CID | 159247234 |
| Molecular Formula | C16H17BrN2O3S |
| Molecular Weight | 397.29 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | 1-bromobutane;1-(thiophen-3-ylmethyl)pyrido[2,3-d][1,3]oxazine-2,4-dione |
| SMILES | CCCCBr.O=c1oc(=O)n(Cc2ccsc2)c2ncccc12 |
| InChI | InChI=1S/C12H8N2O3S.C4H9Br/c15-11-9-2-1-4-13-10(9)14(12(16)17-11)6-8-3-5-18-7-8;1-2-3-4-5/h1-5,7H,6H2;2-4H2,1H3 |
| InChIKey | KUVHZVYPUVPMHZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.29 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|