C43H24F6N6O8 — CID 159247498
(5-amino-2-pyridinyl) 2-[4-[2-[4-[5-[(5-amino-2-pyridinyl)oxycarbonyl]-1,3-dioxoisoindol-2-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 159247498) has the molecular formula C43H24F6N6O8 and a molecular weight of 866.69 g/mol. Its IUPAC name is (5-amino-2-pyridinyl) 2-[4-[2-[4-[5-[(5-amino-2-pyridinyl)oxycarbonyl]-1,3-dioxoisoindol-2-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (5-amino-2-pyridinyl) 2-[4-[2-[4-[5-[(5-amino-2-pyridinyl)oxycarbonyl]-1,3-dioxoisoindol-2-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 159247498 |
| Molecular Formula | C43H24F6N6O8 |
| Molecular Weight | 866.69 g/mol |
| Exact Mass | 866.16 |
| IUPAC Name | (5-amino-2-pyridinyl) 2-[4-[2-[4-[5-[(5-amino-2-pyridinyl)oxycarbonyl]-1,3-dioxoisoindol-2-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Nc1ccc(OC(=O)c2ccc3c(c2)C(=O)N(c2ccc(C(c4ccc(N5C(=O)c6ccc(C(=O)Oc7ccc(N)cn7)cc6C5=O)cc4)(C(F)(F)F)C(F)(F)F)cc2)C3=O)nc1 |
| InChI | InChI=1S/C43H24F6N6O8/c44-42(45,46)41(43(47,48)49,23-3-9-27(10-4-23)54-35(56)29-13-1-21(17-31(29)37(54)58)39(60)62-33-15-7-25(50)19-52-33)24-5-11-28(12-6-24)55-36(57)30-14-2-22(18-32(30)38(55)59)40(61)63-34-16-8-26(51)20-53-34/h1-20H,50-51H2 |
| InChIKey | BDBJDOUHOZQYPF-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 205.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.69 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|