C26H23FN4O3S — CID 159247597
N-[7-fluoro-1-(6-prop-2-enoyl-6-azaspiro[3.4]octan-2-yl)benzimidazol-2-yl]-5-(furan-2-yl)thiophene-2-carboxamide (PubChem CID 159247597) has the molecular formula C26H23FN4O3S and a molecular weight of 490.56 g/mol. Its IUPAC name is N-[7-fluoro-1-(6-prop-2-enoyl-6-azaspiro[3.4]octan-2-yl)benzimidazol-2-yl]-5-(furan-2-yl)thiophene-2-carboxamide.
| Compound Name | N-[7-fluoro-1-(6-prop-2-enoyl-6-azaspiro[3.4]octan-2-yl)benzimidazol-2-yl]-5-(furan-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 159247597 |
| Molecular Formula | C26H23FN4O3S |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | N-[7-fluoro-1-(6-prop-2-enoyl-6-azaspiro[3.4]octan-2-yl)benzimidazol-2-yl]-5-(furan-2-yl)thiophene-2-carboxamide |
| SMILES | C=CC(=O)N1CCC2(CC(n3c(NC(=O)c4ccc(-c5ccco5)s4)nc4cccc(F)c43)C2)C1 |
| InChI | InChI=1S/C26H23FN4O3S/c1-2-22(32)30-11-10-26(15-30)13-16(14-26)31-23-17(27)5-3-6-18(23)28-25(31)29-24(33)21-9-8-20(35-21)19-7-4-12-34-19/h2-9,12,16H,1,10-11,13-15H2,(H,28,29,33) |
| InChIKey | IWGTZTSKXZFDLV-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|