C36H38N4O8S — CID 159250155
(2S)-N-[(1R,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]-4-(7-methoxy-2-phenylquinolin-4-yl)oxy-1-(4-oxohex-5-enoyl)pyrrolidine-2-carboxamide (PubChem CID 159250155) has the molecular formula C36H38N4O8S and a molecular weight of 686.79 g/mol. Its IUPAC name is (2S)-N-[(1R,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]-4-(7-methoxy-2-phenylquinolin-4-yl)oxy-1-(4-oxohex-5-enoyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(1R,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]-4-(7-methoxy-2-phenylquinolin-4-yl)oxy-1-(4-oxohex-5-enoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 159250155 |
| Molecular Formula | C36H38N4O8S |
| Molecular Weight | 686.79 g/mol |
| Exact Mass | 686.24 |
| IUPAC Name | (2S)-N-[(1R,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]-4-(7-methoxy-2-phenylquinolin-4-yl)oxy-1-(4-oxohex-5-enoyl)pyrrolidine-2-carboxamide |
| SMILES | C=CC(=O)CCC(=O)N1CC(Oc2cc(-c3ccccc3)nc3cc(OC)ccc23)C[C@H]1C(=O)N[C@]1(C(=O)NS(=O)(=O)C2CC2)C[C@H]1C=C |
| InChI | InChI=1S/C36H38N4O8S/c1-4-23-20-36(23,35(44)39-49(45,46)27-13-14-27)38-34(43)31-18-26(21-40(31)33(42)16-11-24(41)5-2)48-32-19-29(22-9-7-6-8-10-22)37-30-17-25(47-3)12-15-28(30)32/h4-10,12,15,17,19,23,26-27,31H,1-2,11,13-14,16,18,20-21H2,3H3,(H,38,43)(H,39,44)/t23-,26?,31+,36-/m1/s1 |
| InChIKey | XPSHWVMDRGIKPR-QTJOEBBLSA-N |
| XLogP | 3.46 |
| TPSA | 161.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.79 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|