About [1-[(2-fluoro-1,3-thiazol-5-yl)methyl]-5,6-dihydro-4H-pyrimidin-2-yl]cyanamide
[1-[(2-fluoro-1,3-thiazol-5-yl)methyl]-5,6-dihydro-4H-pyrimidin-2-yl]cyanamide (PubChem CID 15925069) has the molecular formula C9H10FN5S
and a molecular weight of 239.28 g/mol. Its IUPAC name is [1-[(2-fluoro-1,3-thiazol-5-yl)methyl]-5,6-dihydro-4H-pyrimidin-2-yl]cyanamide.
Molecular Properties
| Compound Name | [1-[(2-fluoro-1,3-thiazol-5-yl)methyl]-5,6-dihydro-4H-pyrimidin-2-yl]cyanamide |
| PubChem CID | 15925069 |
| Molecular Formula | C9H10FN5S |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | [1-[(2-fluoro-1,3-thiazol-5-yl)methyl]-5,6-dihydro-4H-pyrimidin-2-yl]cyanamide |
| SMILES | N#CNC1=NCCCN1Cc1cnc(F)s1 |
| InChI | InChI=1S/C9H10FN5S/c10-8-13-4-7(16-8)5-15-3-1-2-12-9(15)14-6-11/h4H,1-3,5H2,(H,12,14) |
| InChIKey | RFZQXKRTAWAVGG-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 64.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze [1-[(2-fluoro-1,3-thiazol-5-yl)methyl]-5,6-dihydro-4H-pyrimidin-2-yl]cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(2-fluoro-1,3-thiazol-5-yl)methyl]-5,6-dihydro-4H-pyrimidin-2-yl]cyanamide?
The IUPAC name of [1-[(2-fluoro-1,3-thiazol-5-yl)methyl]-5,6-dihydro-4H-pyrimidin-2-yl]cyanamide (CID 15925069) is [1-[(2-fluoro-1,3-thiazol-5-yl)methyl]-5,6-dihydro-4H-pyrimidin-2-yl]cyanamide.
What is the SMILES notation for [1-[(2-fluoro-1,3-thiazol-5-yl)methyl]-5,6-dihydro-4H-pyrimidin-2-yl]cyanamide?
The canonical SMILES for [1-[(2-fluoro-1,3-thiazol-5-yl)methyl]-5,6-dihydro-4H-pyrimidin-2-yl]cyanamide is N#CNC1=NCCCN1Cc1cnc(F)s1.
What is the InChIKey of [1-[(2-fluoro-1,3-thiazol-5-yl)methyl]-5,6-dihydro-4H-pyrimidin-2-yl]cyanamide?
The InChIKey is RFZQXKRTAWAVGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FN5S/c10-8-13-4-7(16-8)5-15-3-1-2-12-9(15)14-6-11/h4H,1-3,5H2,(H,12,14).
What are the key properties of [1-[(2-fluoro-1,3-thiazol-5-yl)methyl]-5,6-dihydro-4H-pyrimidin-2-yl]cyanamide?
[1-[(2-fluoro-1,3-thiazol-5-yl)methyl]-5,6-dihydro-4H-pyrimidin-2-yl]cyanamide has a molecular weight of 239.28 g/mol, XLogP of 0.91, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(2-fluoro-1,3-thiazol-5-yl)methyl]-5,6-dihydro-4H-pyrimidin-2-yl]cyanamide is sourced from PubChem (CID 15925069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).