About [3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3-thiazinan-2-ylidene]cyanamide
[3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3-thiazinan-2-ylidene]cyanamide (PubChem CID 15925117) has the molecular formula C9H9ClN4S2
and a molecular weight of 272.79 g/mol. Its IUPAC name is [3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3-thiazinan-2-ylidene]cyanamide.
Molecular Properties
| Compound Name | [3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3-thiazinan-2-ylidene]cyanamide |
| PubChem CID | 15925117 |
| Molecular Formula | C9H9ClN4S2 |
| Molecular Weight | 272.79 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | [3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3-thiazinan-2-ylidene]cyanamide |
| SMILES | N#C/N=C1\SCCCN1Cc1cnc(Cl)s1 |
| InChI | InChI=1S/C9H9ClN4S2/c10-8-12-4-7(16-8)5-14-2-1-3-15-9(14)13-6-11/h4H,1-3,5H2/b13-9- |
| InChIKey | JGLSGWGSWQOYDD-LCYFTJDESA-N |
| XLogP | 2.57 |
| TPSA | 52.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.79 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3-thiazinan-2-ylidene]cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3-thiazinan-2-ylidene]cyanamide?
The IUPAC name of [3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3-thiazinan-2-ylidene]cyanamide (CID 15925117) is [3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3-thiazinan-2-ylidene]cyanamide.
What is the SMILES notation for [3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3-thiazinan-2-ylidene]cyanamide?
The canonical SMILES for [3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3-thiazinan-2-ylidene]cyanamide is N#C/N=C1\SCCCN1Cc1cnc(Cl)s1.
What is the InChIKey of [3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3-thiazinan-2-ylidene]cyanamide?
The InChIKey is JGLSGWGSWQOYDD-LCYFTJDESA-N. The full InChI is InChI=1S/C9H9ClN4S2/c10-8-12-4-7(16-8)5-14-2-1-3-15-9(14)13-6-11/h4H,1-3,5H2/b13-9-.
What are the key properties of [3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3-thiazinan-2-ylidene]cyanamide?
[3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3-thiazinan-2-ylidene]cyanamide has a molecular weight of 272.79 g/mol, XLogP of 2.57, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3-thiazinan-2-ylidene]cyanamide is sourced from PubChem (CID 15925117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).