About acetic acid;2,3,5-trimethylpyrazine
acetic acid;2,3,5-trimethylpyrazine (PubChem CID 159251290) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is acetic acid;2,3,5-trimethylpyrazine.
Molecular Properties
| Compound Name | acetic acid;2,3,5-trimethylpyrazine |
| PubChem CID | 159251290 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | acetic acid;2,3,5-trimethylpyrazine |
| SMILES | CC(=O)O.Cc1cnc(C)c(C)n1 |
| InChI | InChI=1S/C7H10N2.C2H4O2/c1-5-4-8-6(2)7(3)9-5;1-2(3)4/h4H,1-3H3;1H3,(H,3,4) |
| InChIKey | KVIFWNRQBQJJRV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetic acid;2,3,5-trimethylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;2,3,5-trimethylpyrazine?
The IUPAC name of acetic acid;2,3,5-trimethylpyrazine (CID 159251290) is acetic acid;2,3,5-trimethylpyrazine.
What is the SMILES notation for acetic acid;2,3,5-trimethylpyrazine?
The canonical SMILES for acetic acid;2,3,5-trimethylpyrazine is CC(=O)O.Cc1cnc(C)c(C)n1.
What is the InChIKey of acetic acid;2,3,5-trimethylpyrazine?
The InChIKey is KVIFWNRQBQJJRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.C2H4O2/c1-5-4-8-6(2)7(3)9-5;1-2(3)4/h4H,1-3H3;1H3,(H,3,4).
What are the key properties of acetic acid;2,3,5-trimethylpyrazine?
acetic acid;2,3,5-trimethylpyrazine has a molecular weight of 182.22 g/mol, XLogP of 1.49, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2,3,5-trimethylpyrazine is sourced from PubChem (CID 159251290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).