About 2-[(2,6-dichloro-3-methylphenoxy)methyl]-4,5-dihydro-1H-imidazole
2-[(2,6-dichloro-3-methylphenoxy)methyl]-4,5-dihydro-1H-imidazole (PubChem CID 159251315) has the molecular formula C11H12Cl2N2O
and a molecular weight of 259.14 g/mol. Its IUPAC name is 2-[(2,6-dichloro-3-methylphenoxy)methyl]-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 2-[(2,6-dichloro-3-methylphenoxy)methyl]-4,5-dihydro-1H-imidazole |
| PubChem CID | 159251315 |
| Molecular Formula | C11H12Cl2N2O |
| Molecular Weight | 259.14 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 2-[(2,6-dichloro-3-methylphenoxy)methyl]-4,5-dihydro-1H-imidazole |
| SMILES | Cc1ccc(Cl)c(OCC2=NCCN2)c1Cl |
| InChI | InChI=1S/C11H12Cl2N2O/c1-7-2-3-8(12)11(10(7)13)16-6-9-14-4-5-15-9/h2-3H,4-6H2,1H3,(H,14,15) |
| InChIKey | NGNYKRYWOQVWDR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.14 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2,6-dichloro-3-methylphenoxy)methyl]-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,6-dichloro-3-methylphenoxy)methyl]-4,5-dihydro-1H-imidazole?
The IUPAC name of 2-[(2,6-dichloro-3-methylphenoxy)methyl]-4,5-dihydro-1H-imidazole (CID 159251315) is 2-[(2,6-dichloro-3-methylphenoxy)methyl]-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 2-[(2,6-dichloro-3-methylphenoxy)methyl]-4,5-dihydro-1H-imidazole?
The canonical SMILES for 2-[(2,6-dichloro-3-methylphenoxy)methyl]-4,5-dihydro-1H-imidazole is Cc1ccc(Cl)c(OCC2=NCCN2)c1Cl.
What is the InChIKey of 2-[(2,6-dichloro-3-methylphenoxy)methyl]-4,5-dihydro-1H-imidazole?
The InChIKey is NGNYKRYWOQVWDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Cl2N2O/c1-7-2-3-8(12)11(10(7)13)16-6-9-14-4-5-15-9/h2-3H,4-6H2,1H3,(H,14,15).
What are the key properties of 2-[(2,6-dichloro-3-methylphenoxy)methyl]-4,5-dihydro-1H-imidazole?
2-[(2,6-dichloro-3-methylphenoxy)methyl]-4,5-dihydro-1H-imidazole has a molecular weight of 259.14 g/mol, XLogP of 2.68, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,6-dichloro-3-methylphenoxy)methyl]-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 159251315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).