C35H27ClF3N5 — CID 159251635
2-[2-(4-chlorophenyl)ethyl]-8-methylbenzo[f][1,7]naphthyridin-5-amine;8-(trifluoromethyl)phenanthridin-6-amine (PubChem CID 159251635) has the molecular formula C35H27ClF3N5 and a molecular weight of 610.08 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)ethyl]-8-methylbenzo[f][1,7]naphthyridin-5-amine;8-(trifluoromethyl)phenanthridin-6-amine.
| Compound Name | 2-[2-(4-chlorophenyl)ethyl]-8-methylbenzo[f][1,7]naphthyridin-5-amine;8-(trifluoromethyl)phenanthridin-6-amine |
|---|---|
| PubChem CID | 159251635 |
| Molecular Formula | C35H27ClF3N5 |
| Molecular Weight | 610.08 g/mol |
| Exact Mass | 609.19 |
| IUPAC Name | 2-[2-(4-chlorophenyl)ethyl]-8-methylbenzo[f][1,7]naphthyridin-5-amine;8-(trifluoromethyl)phenanthridin-6-amine |
| SMILES | Cc1ccc2c(c1)nc(N)c1ncc(CCc3ccc(Cl)cc3)cc12.Nc1nc2ccccc2c2ccc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C21H18ClN3.C14H9F3N2/c1-13-2-9-17-18-11-15(4-3-14-5-7-16(22)8-6-14)12-24-20(18)21(23)25-19(17)10-13;15-14(16,17)8-5-6-9-10-3-1-2-4-12(10)19-13(18)11(9)7-8/h2,5-12H,3-4H2,1H3,(H2,23,25);1-7H,(H2,18,19) |
| InChIKey | KVJHAVRJCTUQJG-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.08 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|