About 5-bromo-2-methylpyridine;ethyl 2-(5-phenyl-2-pyridinyl)acetate;2-methyl-5-phenylpyridine
5-bromo-2-methylpyridine;ethyl 2-(5-phenyl-2-pyridinyl)acetate;2-methyl-5-phenylpyridine (PubChem CID 159251873) has the molecular formula C33H32BrN3O2
and a molecular weight of 582.54 g/mol. Its IUPAC name is 5-bromo-2-methylpyridine;ethyl 2-(5-phenyl-2-pyridinyl)acetate;2-methyl-5-phenylpyridine.
Molecular Properties
| Compound Name | 5-bromo-2-methylpyridine;ethyl 2-(5-phenyl-2-pyridinyl)acetate;2-methyl-5-phenylpyridine |
| PubChem CID | 159251873 |
| Molecular Formula | C33H32BrN3O2 |
| Molecular Weight | 582.54 g/mol |
| Exact Mass | 581.17 |
| IUPAC Name | 5-bromo-2-methylpyridine;ethyl 2-(5-phenyl-2-pyridinyl)acetate;2-methyl-5-phenylpyridine |
| SMILES | CCOC(=O)Cc1ccc(-c2ccccc2)cn1.Cc1ccc(-c2ccccc2)cn1.Cc1ccc(Br)cn1 |
| InChI | InChI=1S/C15H15NO2.C12H11N.C6H6BrN/c1-2-18-15(17)10-14-9-8-13(11-16-14)12-6-4-3-5-7-12;1-10-7-8-12(9-13-10)11-5-3-2-4-6-11;1-5-2-3-6(7)4-8-5/h3-9,11H,2,10H2,1H3;2-9H,1H3;2-4H,1H3 |
| InChIKey | KVJZEYHOEOUGFF-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 582.54 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-2-methylpyridine;ethyl 2-(5-phenyl-2-pyridinyl)acetate;2-methyl-5-phenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-methylpyridine;ethyl 2-(5-phenyl-2-pyridinyl)acetate;2-methyl-5-phenylpyridine?
The IUPAC name of 5-bromo-2-methylpyridine;ethyl 2-(5-phenyl-2-pyridinyl)acetate;2-methyl-5-phenylpyridine (CID 159251873) is 5-bromo-2-methylpyridine;ethyl 2-(5-phenyl-2-pyridinyl)acetate;2-methyl-5-phenylpyridine.
What is the SMILES notation for 5-bromo-2-methylpyridine;ethyl 2-(5-phenyl-2-pyridinyl)acetate;2-methyl-5-phenylpyridine?
The canonical SMILES for 5-bromo-2-methylpyridine;ethyl 2-(5-phenyl-2-pyridinyl)acetate;2-methyl-5-phenylpyridine is CCOC(=O)Cc1ccc(-c2ccccc2)cn1.Cc1ccc(-c2ccccc2)cn1.Cc1ccc(Br)cn1.
What is the InChIKey of 5-bromo-2-methylpyridine;ethyl 2-(5-phenyl-2-pyridinyl)acetate;2-methyl-5-phenylpyridine?
The InChIKey is KVJZEYHOEOUGFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO2.C12H11N.C6H6BrN/c1-2-18-15(17)10-14-9-8-13(11-16-14)12-6-4-3-5-7-12;1-10-7-8-12(9-13-10)11-5-3-2-4-6-11;1-5-2-3-6(7)4-8-5/h3-9,11H,2,10H2,1H3;2-9H,1H3;2-4H,1H3.
What are the key properties of 5-bromo-2-methylpyridine;ethyl 2-(5-phenyl-2-pyridinyl)acetate;2-methyl-5-phenylpyridine?
5-bromo-2-methylpyridine;ethyl 2-(5-phenyl-2-pyridinyl)acetate;2-methyl-5-phenylpyridine has a molecular weight of 582.54 g/mol, XLogP of 8.06, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-methylpyridine;ethyl 2-(5-phenyl-2-pyridinyl)acetate;2-methyl-5-phenylpyridine is sourced from PubChem (CID 159251873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).