About (E)-1-bromohept-1-ene;[(E)-hept-1-enyl]-hydroxy-dimethylsilane
(E)-1-bromohept-1-ene;[(E)-hept-1-enyl]-hydroxy-dimethylsilane (PubChem CID 159252246) has the molecular formula C16H33BrOSi
and a molecular weight of 349.43 g/mol. Its IUPAC name is (E)-1-bromohept-1-ene;[(E)-hept-1-enyl]-hydroxy-dimethylsilane.
Molecular Properties
| Compound Name | (E)-1-bromohept-1-ene;[(E)-hept-1-enyl]-hydroxy-dimethylsilane |
| PubChem CID | 159252246 |
| Molecular Formula | C16H33BrOSi |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (E)-1-bromohept-1-ene;[(E)-hept-1-enyl]-hydroxy-dimethylsilane |
| SMILES | CCCCC/C=C/Br.CCCCC/C=C/[Si](C)(C)O |
| InChI | InChI=1S/C9H20OSi.C7H13Br/c1-4-5-6-7-8-9-11(2,3)10;1-2-3-4-5-6-7-8/h8-10H,4-7H2,1-3H3;6-7H,2-5H2,1H3/b9-8+;7-6+ |
| InChIKey | KVLFINTTXPAMCJ-VKVHLROJSA-N |
| XLogP | 6.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-bromohept-1-ene;[(E)-hept-1-enyl]-hydroxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-bromohept-1-ene;[(E)-hept-1-enyl]-hydroxy-dimethylsilane?
The IUPAC name of (E)-1-bromohept-1-ene;[(E)-hept-1-enyl]-hydroxy-dimethylsilane (CID 159252246) is (E)-1-bromohept-1-ene;[(E)-hept-1-enyl]-hydroxy-dimethylsilane.
What is the SMILES notation for (E)-1-bromohept-1-ene;[(E)-hept-1-enyl]-hydroxy-dimethylsilane?
The canonical SMILES for (E)-1-bromohept-1-ene;[(E)-hept-1-enyl]-hydroxy-dimethylsilane is CCCCC/C=C/Br.CCCCC/C=C/[Si](C)(C)O.
What is the InChIKey of (E)-1-bromohept-1-ene;[(E)-hept-1-enyl]-hydroxy-dimethylsilane?
The InChIKey is KVLFINTTXPAMCJ-VKVHLROJSA-N. The full InChI is InChI=1S/C9H20OSi.C7H13Br/c1-4-5-6-7-8-9-11(2,3)10;1-2-3-4-5-6-7-8/h8-10H,4-7H2,1-3H3;6-7H,2-5H2,1H3/b9-8+;7-6+.
What are the key properties of (E)-1-bromohept-1-ene;[(E)-hept-1-enyl]-hydroxy-dimethylsilane?
(E)-1-bromohept-1-ene;[(E)-hept-1-enyl]-hydroxy-dimethylsilane has a molecular weight of 349.43 g/mol, XLogP of 6.33, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-bromohept-1-ene;[(E)-hept-1-enyl]-hydroxy-dimethylsilane is sourced from PubChem (CID 159252246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).