C21H27N3S2 — CID 15925239
10-[1-(dimethylamino)propan-2-yl]-N-propylphenothiazine-2-carbothioamide (PubChem CID 15925239) has the molecular formula C21H27N3S2 and a molecular weight of 385.60 g/mol. Its IUPAC name is 10-[1-(dimethylamino)propan-2-yl]-N-propylphenothiazine-2-carbothioamide.
| Compound Name | 10-[1-(dimethylamino)propan-2-yl]-N-propylphenothiazine-2-carbothioamide |
|---|---|
| PubChem CID | 15925239 |
| Molecular Formula | C21H27N3S2 |
| Molecular Weight | 385.60 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 10-[1-(dimethylamino)propan-2-yl]-N-propylphenothiazine-2-carbothioamide |
| SMILES | CCCNC(=S)c1ccc2c(c1)N(C(C)CN(C)C)c1ccccc1S2 |
| InChI | InChI=1S/C21H27N3S2/c1-5-12-22-21(25)16-10-11-20-18(13-16)24(15(2)14-23(3)4)17-8-6-7-9-19(17)26-20/h6-11,13,15H,5,12,14H2,1-4H3,(H,22,25) |
| InChIKey | GWFCDZWMUJHOKN-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|