C31H28ClN9O4S2 — CID 159252451
4-chloro-2-methylsulfanylpyrimidine;2-methylsulfanyl-4-[2-[(3-nitrophenyl)methyl]imidazol-1-yl]pyrimidine;2-[(3-nitrophenyl)methyl]-3H-pyrrole (PubChem CID 159252451) has the molecular formula C31H28ClN9O4S2 and a molecular weight of 690.21 g/mol. Its IUPAC name is 4-chloro-2-methylsulfanylpyrimidine;2-methylsulfanyl-4-[2-[(3-nitrophenyl)methyl]imidazol-1-yl]pyrimidine;2-[(3-nitrophenyl)methyl]-3H-pyrrole.
| Compound Name | 4-chloro-2-methylsulfanylpyrimidine;2-methylsulfanyl-4-[2-[(3-nitrophenyl)methyl]imidazol-1-yl]pyrimidine;2-[(3-nitrophenyl)methyl]-3H-pyrrole |
|---|---|
| PubChem CID | 159252451 |
| Molecular Formula | C31H28ClN9O4S2 |
| Molecular Weight | 690.21 g/mol |
| Exact Mass | 689.14 |
| IUPAC Name | 4-chloro-2-methylsulfanylpyrimidine;2-methylsulfanyl-4-[2-[(3-nitrophenyl)methyl]imidazol-1-yl]pyrimidine;2-[(3-nitrophenyl)methyl]-3H-pyrrole |
| SMILES | CSc1nccc(-n2ccnc2Cc2cccc([N+](=O)[O-])c2)n1.CSc1nccc(Cl)n1.O=[N+]([O-])c1cccc(CC2=NC=CC2)c1 |
| InChI | InChI=1S/C15H13N5O2S.C11H10N2O2.C5H5ClN2S/c1-23-15-17-6-5-13(18-15)19-8-7-16-14(19)10-11-3-2-4-12(9-11)20(21)22;14-13(15)11-5-1-3-9(8-11)7-10-4-2-6-12-10;1-9-5-7-3-2-4(6)8-5/h2-9H,10H2,1H3;1-3,5-6,8H,4,7H2;2-3H,1H3 |
| InChIKey | KVLWOIKDIMGSJB-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 168.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.21 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|