C27H28Cl2F3N3O5S — CID 159253867
1-cyclopropyl-N-hydroxy-4-[4-[5-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxamide;dihydrochloride (PubChem CID 159253867) has the molecular formula C27H28Cl2F3N3O5S and a molecular weight of 634.50 g/mol. Its IUPAC name is 1-cyclopropyl-N-hydroxy-4-[4-[5-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxamide;dihydrochloride.
| Compound Name | 1-cyclopropyl-N-hydroxy-4-[4-[5-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 159253867 |
| Molecular Formula | C27H28Cl2F3N3O5S |
| Molecular Weight | 634.50 g/mol |
| Exact Mass | 633.11 |
| IUPAC Name | 1-cyclopropyl-N-hydroxy-4-[4-[5-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NO)C1(S(=O)(=O)c2ccc(-c3ccc(-c4ccc(OC(F)(F)F)cc4)cn3)cc2)CCN(C2CC2)CC1 |
| InChI | InChI=1S/C27H26F3N3O5S.2ClH/c28-27(29,30)38-22-8-1-18(2-9-22)20-5-12-24(31-17-20)19-3-10-23(11-4-19)39(36,37)26(25(34)32-35)13-15-33(16-14-26)21-6-7-21;;/h1-5,8-12,17,21,35H,6-7,13-16H2,(H,32,34);2*1H |
| InChIKey | CSKAMTZONSBMDK-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|