C20H18O7 — CID 159254163
4-hydroxybenzaldehyde;5-[(4-hydroxyphenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 159254163) has the molecular formula C20H18O7 and a molecular weight of 370.36 g/mol. Its IUPAC name is 4-hydroxybenzaldehyde;5-[(4-hydroxyphenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 4-hydroxybenzaldehyde;5-[(4-hydroxyphenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 159254163 |
| Molecular Formula | C20H18O7 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 4-hydroxybenzaldehyde;5-[(4-hydroxyphenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=Cc2ccc(O)cc2)C(=O)O1.O=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C13H12O5.C7H6O2/c1-13(2)17-11(15)10(12(16)18-13)7-8-3-5-9(14)6-4-8;8-5-6-1-3-7(9)4-2-6/h3-7,14H,1-2H3;1-5,9H |
| InChIKey | KVRHWDRLPSUORC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|