About 1-fluoro-2-methylprop-1-ene;silane
1-fluoro-2-methylprop-1-ene;silane (PubChem CID 159257141) has the molecular formula C4H11FSi
and a molecular weight of 106.22 g/mol. Its IUPAC name is 1-fluoro-2-methylprop-1-ene;silane.
Molecular Properties
| Compound Name | 1-fluoro-2-methylprop-1-ene;silane |
| PubChem CID | 159257141 |
| Molecular Formula | C4H11FSi |
| Molecular Weight | 106.22 g/mol |
| Exact Mass | 106.06 |
| IUPAC Name | 1-fluoro-2-methylprop-1-ene;silane |
| SMILES | CC(C)=CF.[SiH4] |
| InChI | InChI=1S/C4H7F.H4Si/c1-4(2)3-5;/h3H,1-2H3;1H4 |
| InChIKey | KWASBEJRITUANS-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-2-methylprop-1-ene;silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-2-methylprop-1-ene;silane?
The IUPAC name of 1-fluoro-2-methylprop-1-ene;silane (CID 159257141) is 1-fluoro-2-methylprop-1-ene;silane.
What is the SMILES notation for 1-fluoro-2-methylprop-1-ene;silane?
The canonical SMILES for 1-fluoro-2-methylprop-1-ene;silane is CC(C)=CF.[SiH4].
What is the InChIKey of 1-fluoro-2-methylprop-1-ene;silane?
The InChIKey is KWASBEJRITUANS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7F.H4Si/c1-4(2)3-5;/h3H,1-2H3;1H4.
What are the key properties of 1-fluoro-2-methylprop-1-ene;silane?
1-fluoro-2-methylprop-1-ene;silane has a molecular weight of 106.22 g/mol, XLogP of 0.43, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-2-methylprop-1-ene;silane is sourced from PubChem (CID 159257141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).