C28H34N4O3S — CID 159257184
N-[[4-(2-aminoacetyl)phenyl]methyl]-2-(4-benzylpiperazin-1-yl)-N-phenylethanesulfonamide (PubChem CID 159257184) has the molecular formula C28H34N4O3S and a molecular weight of 506.67 g/mol. Its IUPAC name is N-[[4-(2-aminoacetyl)phenyl]methyl]-2-(4-benzylpiperazin-1-yl)-N-phenylethanesulfonamide.
| Compound Name | N-[[4-(2-aminoacetyl)phenyl]methyl]-2-(4-benzylpiperazin-1-yl)-N-phenylethanesulfonamide |
|---|---|
| PubChem CID | 159257184 |
| Molecular Formula | C28H34N4O3S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | N-[[4-(2-aminoacetyl)phenyl]methyl]-2-(4-benzylpiperazin-1-yl)-N-phenylethanesulfonamide |
| SMILES | NCC(=O)c1ccc(CN(c2ccccc2)S(=O)(=O)CCN2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C28H34N4O3S/c29-21-28(33)26-13-11-25(12-14-26)23-32(27-9-5-2-6-10-27)36(34,35)20-19-30-15-17-31(18-16-30)22-24-7-3-1-4-8-24/h1-14H,15-23,29H2 |
| InChIKey | MINBXCRMBOYBOD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |