C23H26O4 — CID 159257440
[(1'S,4'S,5'R)-spiro[1,3-dihydroindene-2,3'-6,8-dioxabicyclo[3.2.1]octane]-4'-yl] 3-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 159257440) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is [(1'S,4'S,5'R)-spiro[1,3-dihydroindene-2,3'-6,8-dioxabicyclo[3.2.1]octane]-4'-yl] 3-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [(1'S,4'S,5'R)-spiro[1,3-dihydroindene-2,3'-6,8-dioxabicyclo[3.2.1]octane]-4'-yl] 3-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 159257440 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | [(1'S,4'S,5'R)-spiro[1,3-dihydroindene-2,3'-6,8-dioxabicyclo[3.2.1]octane]-4'-yl] 3-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC1C2C=CC(C2)C1C(=O)O[C@@H]1[C@@H]2OC[C@H](CC13Cc1ccccc1C3)O2 |
| InChI | InChI=1S/C23H26O4/c1-13-14-6-7-15(8-14)19(13)21(24)27-20-22-25-12-18(26-22)11-23(20)9-16-4-2-3-5-17(16)10-23/h2-7,13-15,18-20,22H,8-12H2,1H3/t13?,14?,15?,18-,19?,20+,22+/m0/s1 |
| InChIKey | KWBQTOUVCOEWGI-AOCYKPFHSA-N |
| XLogP | 3.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|