C42H55F3N4O2 — CID 159258198
(3R)-N-(2,2-dimethylpropyl)-3-[4-[4-[4-[2-[(3R)-1-(2,2-dimethylpropylamino)-1-oxohexan-3-yl]-3H-pyrrol-4-yl]phenyl]phenyl]-3H-pyrrol-2-yl]-6,6,6-trifluorohexanamide (PubChem CID 159258198) has the molecular formula C42H55F3N4O2 and a molecular weight of 704.92 g/mol. Its IUPAC name is (3R)-N-(2,2-dimethylpropyl)-3-[4-[4-[4-[2-[(3R)-1-(2,2-dimethylpropylamino)-1-oxohexan-3-yl]-3H-pyrrol-4-yl]phenyl]phenyl]-3H-pyrrol-2-yl]-6,6,6-trifluorohexanamide.
| Compound Name | (3R)-N-(2,2-dimethylpropyl)-3-[4-[4-[4-[2-[(3R)-1-(2,2-dimethylpropylamino)-1-oxohexan-3-yl]-3H-pyrrol-4-yl]phenyl]phenyl]-3H-pyrrol-2-yl]-6,6,6-trifluorohexanamide |
|---|---|
| PubChem CID | 159258198 |
| Molecular Formula | C42H55F3N4O2 |
| Molecular Weight | 704.92 g/mol |
| Exact Mass | 704.43 |
| IUPAC Name | (3R)-N-(2,2-dimethylpropyl)-3-[4-[4-[4-[2-[(3R)-1-(2,2-dimethylpropylamino)-1-oxohexan-3-yl]-3H-pyrrol-4-yl]phenyl]phenyl]-3H-pyrrol-2-yl]-6,6,6-trifluorohexanamide |
| SMILES | CCC[C@H](CC(=O)NCC(C)(C)C)C1=NC=C(c2ccc(-c3ccc(C4=CN=C([C@H](CCC(F)(F)F)CC(=O)NCC(C)(C)C)C4)cc3)cc2)C1 |
| InChI | InChI=1S/C42H55F3N4O2/c1-8-9-32(22-38(50)48-26-40(2,3)4)36-20-34(24-46-36)30-14-10-28(11-15-30)29-12-16-31(17-13-29)35-21-37(47-25-35)33(18-19-42(43,44)45)23-39(51)49-27-41(5,6)7/h10-17,24-25,32-33H,8-9,18-23,26-27H2,1-7H3,(H,48,50)(H,49,51)/t32-,33-/m1/s1 |
| InChIKey | OWWDHUAWYPTMNN-CZNDPXEESA-N |
| XLogP | 10.20 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.92 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |