C24H22FNO4 — CID 159258211
16-fluoro-20-heptyl-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13(18),14,16-heptaene-11,19-dione (PubChem CID 159258211) has the molecular formula C24H22FNO4 and a molecular weight of 407.44 g/mol. Its IUPAC name is 16-fluoro-20-heptyl-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13(18),14,16-heptaene-11,19-dione.
| Compound Name | 16-fluoro-20-heptyl-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13(18),14,16-heptaene-11,19-dione |
|---|---|
| PubChem CID | 159258211 |
| Molecular Formula | C24H22FNO4 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 16-fluoro-20-heptyl-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13(18),14,16-heptaene-11,19-dione |
| SMILES | CCCCCCCn1c2c(c3ccc(F)cc3c1=O)C(=O)c1cc3c(cc1-2)OCO3 |
| InChI | InChI=1S/C24H22FNO4/c1-2-3-4-5-6-9-26-22-16-11-19-20(30-13-29-19)12-17(16)23(27)21(22)15-8-7-14(25)10-18(15)24(26)28/h7-8,10-12H,2-6,9,13H2,1H3 |
| InChIKey | NFXJVJMZXJQBHR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|