C15H32O5 — CID 159259750
2,2-dimethylpropane-1,3-diol;3-hydroxy-2,2,5,5-tetramethylhexanoic acid (PubChem CID 159259750) has the molecular formula C15H32O5 and a molecular weight of 292.42 g/mol. Its IUPAC name is 2,2-dimethylpropane-1,3-diol;3-hydroxy-2,2,5,5-tetramethylhexanoic acid.
| Compound Name | 2,2-dimethylpropane-1,3-diol;3-hydroxy-2,2,5,5-tetramethylhexanoic acid |
|---|---|
| PubChem CID | 159259750 |
| Molecular Formula | C15H32O5 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 2,2-dimethylpropane-1,3-diol;3-hydroxy-2,2,5,5-tetramethylhexanoic acid |
| SMILES | CC(C)(C)CC(O)C(C)(C)C(=O)O.CC(C)(CO)CO |
| InChI | InChI=1S/C10H20O3.C5H12O2/c1-9(2,3)6-7(11)10(4,5)8(12)13;1-5(2,3-6)4-7/h7,11H,6H2,1-5H3,(H,12,13);6-7H,3-4H2,1-2H3 |
| InChIKey | KWIVILRSNXIJOX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |