C20H23Cl2NO4S — CID 159260114
[2-(2,6-dichlorophenyl)acetyl]-[2,6-di(propan-2-yl)phenyl]sulfamic acid (PubChem CID 159260114) has the molecular formula C20H23Cl2NO4S and a molecular weight of 444.38 g/mol. Its IUPAC name is [2-(2,6-dichlorophenyl)acetyl]-[2,6-di(propan-2-yl)phenyl]sulfamic acid.
| Compound Name | [2-(2,6-dichlorophenyl)acetyl]-[2,6-di(propan-2-yl)phenyl]sulfamic acid |
|---|---|
| PubChem CID | 159260114 |
| Molecular Formula | C20H23Cl2NO4S |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | [2-(2,6-dichlorophenyl)acetyl]-[2,6-di(propan-2-yl)phenyl]sulfamic acid |
| SMILES | CC(C)c1cccc(C(C)C)c1N(C(=O)Cc1c(Cl)cccc1Cl)S(=O)(=O)O |
| InChI | InChI=1S/C20H23Cl2NO4S/c1-12(2)14-7-5-8-15(13(3)4)20(14)23(28(25,26)27)19(24)11-16-17(21)9-6-10-18(16)22/h5-10,12-13H,11H2,1-4H3,(H,25,26,27) |
| InChIKey | KWJYXWHMFIUUNL-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|