C44H29N4O- — CID 159261054
carbanide;9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-23-oxa-9-azahexacyclo[11.11.0.02,10.03,8.016,24.017,22]tetracosa-1(13),2(10),3,5,7,11,14,16(24),17,19,21-undecaene (PubChem CID 159261054) has the molecular formula C44H29N4O- and a molecular weight of 629.74 g/mol. Its IUPAC name is carbanide;9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-23-oxa-9-azahexacyclo[11.11.0.02,10.03,8.016,24.017,22]tetracosa-1(13),2(10),3,5,7,11,14,16(24),17,19,21-undecaene.
| Compound Name | carbanide;9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-23-oxa-9-azahexacyclo[11.11.0.02,10.03,8.016,24.017,22]tetracosa-1(13),2(10),3,5,7,11,14,16(24),17,19,21-undecaene |
|---|---|
| PubChem CID | 159261054 |
| Molecular Formula | C44H29N4O- |
| Molecular Weight | 629.74 g/mol |
| Exact Mass | 629.23 |
| IUPAC Name | carbanide;9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-23-oxa-9-azahexacyclo[11.11.0.02,10.03,8.016,24.017,22]tetracosa-1(13),2(10),3,5,7,11,14,16(24),17,19,21-undecaene |
| SMILES | [CH3-].c1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3-n3c4ccccc4c4c5c(ccc6c7ccccc7oc65)ccc43)n2)cc1 |
| InChI | InChI=1S/C43H26N4O.CH3/c1-3-13-28(14-4-1)41-44-42(29-15-5-2-6-16-29)46-43(45-41)33-19-8-11-21-35(33)47-34-20-10-7-18-32(34)39-36(47)26-24-27-23-25-31-30-17-9-12-22-37(30)48-40(31)38(27)39;/h1-26H;1H3/q;-1 |
| InChIKey | KWMXJENUZVAWSI-UHFFFAOYSA-N |
| XLogP | 11.47 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.74 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|