About lithium;butane;methylcyclohexane
lithium;butane;methylcyclohexane (PubChem CID 159261631) has the molecular formula C11H23Li
and a molecular weight of 162.25 g/mol. Its IUPAC name is lithium;butane;methylcyclohexane.
Molecular Properties
| Compound Name | lithium;butane;methylcyclohexane |
| PubChem CID | 159261631 |
| Molecular Formula | C11H23Li |
| Molecular Weight | 162.25 g/mol |
| Exact Mass | 162.20 |
| IUPAC Name | lithium;butane;methylcyclohexane |
| SMILES | CC1CCCCC1.[CH2-]CCC.[Li+] |
| InChI | InChI=1S/C7H14.C4H9.Li/c1-7-5-3-2-4-6-7;1-3-4-2;/h7H,2-6H2,1H3;1,3-4H2,2H3;/q;-1;+1 |
| InChIKey | COZFCYDCSQOAKO-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.25 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium;butane;methylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;butane;methylcyclohexane?
The IUPAC name of lithium;butane;methylcyclohexane (CID 159261631) is lithium;butane;methylcyclohexane.
What is the SMILES notation for lithium;butane;methylcyclohexane?
The canonical SMILES for lithium;butane;methylcyclohexane is CC1CCCCC1.[CH2-]CCC.[Li+].
What is the InChIKey of lithium;butane;methylcyclohexane?
The InChIKey is COZFCYDCSQOAKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14.C4H9.Li/c1-7-5-3-2-4-6-7;1-3-4-2;/h7H,2-6H2,1H3;1,3-4H2,2H3;/q;-1;+1.
What are the key properties of lithium;butane;methylcyclohexane?
lithium;butane;methylcyclohexane has a molecular weight of 162.25 g/mol, XLogP of 1.21, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;butane;methylcyclohexane is sourced from PubChem (CID 159261631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).