C21H26O8 — CID 159262713
ethyl 3-(furan-2-yl)-2,2-dimethyl-3-oxopropanoate;ethyl 3-(furan-2-yl)-2-methyl-3-oxopropanoate (PubChem CID 159262713) has the molecular formula C21H26O8 and a molecular weight of 406.43 g/mol. Its IUPAC name is ethyl 3-(furan-2-yl)-2,2-dimethyl-3-oxopropanoate;ethyl 3-(furan-2-yl)-2-methyl-3-oxopropanoate.
| Compound Name | ethyl 3-(furan-2-yl)-2,2-dimethyl-3-oxopropanoate;ethyl 3-(furan-2-yl)-2-methyl-3-oxopropanoate |
|---|---|
| PubChem CID | 159262713 |
| Molecular Formula | C21H26O8 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | ethyl 3-(furan-2-yl)-2,2-dimethyl-3-oxopropanoate;ethyl 3-(furan-2-yl)-2-methyl-3-oxopropanoate |
| SMILES | CCOC(=O)C(C)(C)C(=O)c1ccco1.CCOC(=O)C(C)C(=O)c1ccco1 |
| InChI | InChI=1S/C11H14O4.C10H12O4/c1-4-14-10(13)11(2,3)9(12)8-6-5-7-15-8;1-3-13-10(12)7(2)9(11)8-5-4-6-14-8/h5-7H,4H2,1-3H3;4-7H,3H2,1-2H3 |
| InChIKey | KWSCODGMLVUNKL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 113.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|