About ethyl N-(1-ethylpiperazin-1-ium-1-yl)carbamate;molecular hydrogen
ethyl N-(1-ethylpiperazin-1-ium-1-yl)carbamate;molecular hydrogen (PubChem CID 159264603) has the molecular formula C9H22N3O2+
and a molecular weight of 204.29 g/mol. Its IUPAC name is ethyl N-(1-ethylpiperazin-1-ium-1-yl)carbamate;molecular hydrogen.
Molecular Properties
| Compound Name | ethyl N-(1-ethylpiperazin-1-ium-1-yl)carbamate;molecular hydrogen |
| PubChem CID | 159264603 |
| Molecular Formula | C9H22N3O2+ |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | ethyl N-(1-ethylpiperazin-1-ium-1-yl)carbamate;molecular hydrogen |
| SMILES | CCOC(=O)N[N+]1(CC)CCNCC1.[H][H] |
| InChI | InChI=1S/C9H19N3O2.H2/c1-3-12(7-5-10-6-8-12)11-9(13)14-4-2;/h10H,3-8H2,1-2H3;1H/p+1 |
| InChIKey | KWYBTQFPRBYWKH-UHFFFAOYSA-O |
| XLogP | 0.33 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-(1-ethylpiperazin-1-ium-1-yl)carbamate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(1-ethylpiperazin-1-ium-1-yl)carbamate;molecular hydrogen?
The IUPAC name of ethyl N-(1-ethylpiperazin-1-ium-1-yl)carbamate;molecular hydrogen (CID 159264603) is ethyl N-(1-ethylpiperazin-1-ium-1-yl)carbamate;molecular hydrogen.
What is the SMILES notation for ethyl N-(1-ethylpiperazin-1-ium-1-yl)carbamate;molecular hydrogen?
The canonical SMILES for ethyl N-(1-ethylpiperazin-1-ium-1-yl)carbamate;molecular hydrogen is CCOC(=O)N[N+]1(CC)CCNCC1.[H][H].
What is the InChIKey of ethyl N-(1-ethylpiperazin-1-ium-1-yl)carbamate;molecular hydrogen?
The InChIKey is KWYBTQFPRBYWKH-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H19N3O2.H2/c1-3-12(7-5-10-6-8-12)11-9(13)14-4-2;/h10H,3-8H2,1-2H3;1H/p+1.
What are the key properties of ethyl N-(1-ethylpiperazin-1-ium-1-yl)carbamate;molecular hydrogen?
ethyl N-(1-ethylpiperazin-1-ium-1-yl)carbamate;molecular hydrogen has a molecular weight of 204.29 g/mol, XLogP of 0.33, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(1-ethylpiperazin-1-ium-1-yl)carbamate;molecular hydrogen is sourced from PubChem (CID 159264603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).