C6H9F4N2+ — CID 159270716
(3-amino-1,4,4,4-tetrafluoro-2-methylbut-2-enylidene)-methylazanium (PubChem CID 159270716) has the molecular formula C6H9F4N2+ and a molecular weight of 185.14 g/mol. Its IUPAC name is (3-amino-1,4,4,4-tetrafluoro-2-methylbut-2-enylidene)-methylazanium.
| Compound Name | (3-amino-1,4,4,4-tetrafluoro-2-methylbut-2-enylidene)-methylazanium |
|---|---|
| PubChem CID | 159270716 |
| Molecular Formula | C6H9F4N2+ |
| Molecular Weight | 185.14 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | (3-amino-1,4,4,4-tetrafluoro-2-methylbut-2-enylidene)-methylazanium |
| SMILES | C/[NH+]=C(\F)C(C)=C(N)C(F)(F)F |
| InChI | InChI=1S/C6H8F4N2/c1-3(5(7)12-2)4(11)6(8,9)10/h11H2,1-2H3/p+1/b4-3?,12-5- |
| InChIKey | COWGURFCLFVBFS-CGPLYMGNSA-O |
| XLogP | -0.14 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.14 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|