C24H20F4N2O5 — CID 159270965
2-(2,4-dioxocyclohexyl)-4-fluoro-1-oxo-N-[(1S)-1-[3-(trifluoromethoxy)phenyl]ethyl]-3H-isoindole-5-carboxamide (PubChem CID 159270965) has the molecular formula C24H20F4N2O5 and a molecular weight of 492.43 g/mol. Its IUPAC name is 2-(2,4-dioxocyclohexyl)-4-fluoro-1-oxo-N-[(1S)-1-[3-(trifluoromethoxy)phenyl]ethyl]-3H-isoindole-5-carboxamide.
| Compound Name | 2-(2,4-dioxocyclohexyl)-4-fluoro-1-oxo-N-[(1S)-1-[3-(trifluoromethoxy)phenyl]ethyl]-3H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 159270965 |
| Molecular Formula | C24H20F4N2O5 |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | 2-(2,4-dioxocyclohexyl)-4-fluoro-1-oxo-N-[(1S)-1-[3-(trifluoromethoxy)phenyl]ethyl]-3H-isoindole-5-carboxamide |
| SMILES | C[C@H](NC(=O)c1ccc2c(c1F)CN(C1CCC(=O)CC1=O)C2=O)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C24H20F4N2O5/c1-12(13-3-2-4-15(9-13)35-24(26,27)28)29-22(33)17-7-6-16-18(21(17)25)11-30(23(16)34)19-8-5-14(31)10-20(19)32/h2-4,6-7,9,12,19H,5,8,10-11H2,1H3,(H,29,33)/t12-,19?/m0/s1 |
| InChIKey | KXSCCAWPIHDYAP-HSLMYDHPSA-N |
| XLogP | 3.86 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|