C22H28N2O6 — CID 159271121
3-[[4-(4-cyclohexylbutoxy)-3-nitrophenyl]methyl]piperidine-2,4,6-trione (PubChem CID 159271121) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is 3-[[4-(4-cyclohexylbutoxy)-3-nitrophenyl]methyl]piperidine-2,4,6-trione.
| Compound Name | 3-[[4-(4-cyclohexylbutoxy)-3-nitrophenyl]methyl]piperidine-2,4,6-trione |
|---|---|
| PubChem CID | 159271121 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 3-[[4-(4-cyclohexylbutoxy)-3-nitrophenyl]methyl]piperidine-2,4,6-trione |
| SMILES | O=C1CC(=O)C(Cc2ccc(OCCCCC3CCCCC3)c([N+](=O)[O-])c2)C(=O)N1 |
| InChI | InChI=1S/C22H28N2O6/c25-19-14-21(26)23-22(27)17(19)12-16-9-10-20(18(13-16)24(28)29)30-11-5-4-8-15-6-2-1-3-7-15/h9-10,13,15,17H,1-8,11-12,14H2,(H,23,26,27) |
| InChIKey | KXSPEPSKXDFTMA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|