C15H30N4O3 — CID 159271170
7a-methyl-4,5,6,7-tetrahydro-3aH-2-benzofuran-1,3-dione;N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine (PubChem CID 159271170) has the molecular formula C15H30N4O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is 7a-methyl-4,5,6,7-tetrahydro-3aH-2-benzofuran-1,3-dione;N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine.
| Compound Name | 7a-methyl-4,5,6,7-tetrahydro-3aH-2-benzofuran-1,3-dione;N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 159271170 |
| Molecular Formula | C15H30N4O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | 7a-methyl-4,5,6,7-tetrahydro-3aH-2-benzofuran-1,3-dione;N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine |
| SMILES | CC12CCCCC1C(=O)OC2=O.NCCNCCNCCN |
| InChI | InChI=1S/C9H12O3.C6H18N4/c1-9-5-3-2-4-6(9)7(10)12-8(9)11;7-1-3-9-5-6-10-4-2-8/h6H,2-5H2,1H3;9-10H,1-8H2 |
| InChIKey | KXSSZRZDTIOAMB-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|