C14H36N6O — CID 159271519
N'-[(aminomethylamino)methyl]methanediamine;1-methoxy-N,2,2,6,6-pentamethylpiperidin-4-amine (PubChem CID 159271519) has the molecular formula C14H36N6O and a molecular weight of 304.48 g/mol. Its IUPAC name is N'-[(aminomethylamino)methyl]methanediamine;1-methoxy-N,2,2,6,6-pentamethylpiperidin-4-amine.
| Compound Name | N'-[(aminomethylamino)methyl]methanediamine;1-methoxy-N,2,2,6,6-pentamethylpiperidin-4-amine |
|---|---|
| PubChem CID | 159271519 |
| Molecular Formula | C14H36N6O |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.30 |
| IUPAC Name | N'-[(aminomethylamino)methyl]methanediamine;1-methoxy-N,2,2,6,6-pentamethylpiperidin-4-amine |
| SMILES | CNC1CC(C)(C)N(OC)C(C)(C)C1.NCNCNCN |
| InChI | InChI=1S/C11H24N2O.C3H12N4/c1-10(2)7-9(12-5)8-11(3,4)13(10)14-6;4-1-6-3-7-2-5/h9,12H,7-8H2,1-6H3;6-7H,1-5H2 |
| InChIKey | KXTSZFPCKCSQIO-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|