About 2,4-dimethyl-1-benzothiophen-3-amine;ethanethiol;2-methyl-6-nitrobenzonitrile
2,4-dimethyl-1-benzothiophen-3-amine;ethanethiol;2-methyl-6-nitrobenzonitrile (PubChem CID 159271574) has the molecular formula C20H23N3O2S2
and a molecular weight of 401.56 g/mol. Its IUPAC name is 2,4-dimethyl-1-benzothiophen-3-amine;ethanethiol;2-methyl-6-nitrobenzonitrile.
Molecular Properties
| Compound Name | 2,4-dimethyl-1-benzothiophen-3-amine;ethanethiol;2-methyl-6-nitrobenzonitrile |
| PubChem CID | 159271574 |
| Molecular Formula | C20H23N3O2S2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 2,4-dimethyl-1-benzothiophen-3-amine;ethanethiol;2-methyl-6-nitrobenzonitrile |
| SMILES | CCS.Cc1cccc([N+](=O)[O-])c1C#N.Cc1sc2cccc(C)c2c1N |
| InChI | InChI=1S/C10H11NS.C8H6N2O2.C2H6S/c1-6-4-3-5-8-9(6)10(11)7(2)12-8;1-6-3-2-4-8(10(11)12)7(6)5-9;1-2-3/h3-5H,11H2,1-2H3;2-4H,1H3;3H,2H2,1H3 |
| InChIKey | KXTXLHGURVESBZ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethyl-1-benzothiophen-3-amine;ethanethiol;2-methyl-6-nitrobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-1-benzothiophen-3-amine;ethanethiol;2-methyl-6-nitrobenzonitrile?
The IUPAC name of 2,4-dimethyl-1-benzothiophen-3-amine;ethanethiol;2-methyl-6-nitrobenzonitrile (CID 159271574) is 2,4-dimethyl-1-benzothiophen-3-amine;ethanethiol;2-methyl-6-nitrobenzonitrile.
What is the SMILES notation for 2,4-dimethyl-1-benzothiophen-3-amine;ethanethiol;2-methyl-6-nitrobenzonitrile?
The canonical SMILES for 2,4-dimethyl-1-benzothiophen-3-amine;ethanethiol;2-methyl-6-nitrobenzonitrile is CCS.Cc1cccc([N+](=O)[O-])c1C#N.Cc1sc2cccc(C)c2c1N.
What is the InChIKey of 2,4-dimethyl-1-benzothiophen-3-amine;ethanethiol;2-methyl-6-nitrobenzonitrile?
The InChIKey is KXTXLHGURVESBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NS.C8H6N2O2.C2H6S/c1-6-4-3-5-8-9(6)10(11)7(2)12-8;1-6-3-2-4-8(10(11)12)7(6)5-9;1-2-3/h3-5H,11H2,1-2H3;2-4H,1H3;3H,2H2,1H3.
What are the key properties of 2,4-dimethyl-1-benzothiophen-3-amine;ethanethiol;2-methyl-6-nitrobenzonitrile?
2,4-dimethyl-1-benzothiophen-3-amine;ethanethiol;2-methyl-6-nitrobenzonitrile has a molecular weight of 401.56 g/mol, XLogP of 5.81, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-1-benzothiophen-3-amine;ethanethiol;2-methyl-6-nitrobenzonitrile is sourced from PubChem (CID 159271574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).