About 1-benzyl-2-butyl-4,5-dihydroimidazole
1-benzyl-2-butyl-4,5-dihydroimidazole (PubChem CID 15927213) has the molecular formula C14H20N2
and a molecular weight of 216.33 g/mol. Its IUPAC name is 1-benzyl-2-butyl-4,5-dihydroimidazole.
Molecular Properties
| Compound Name | 1-benzyl-2-butyl-4,5-dihydroimidazole |
| PubChem CID | 15927213 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 1-benzyl-2-butyl-4,5-dihydroimidazole |
| SMILES | CCCCC1=NCCN1Cc1ccccc1 |
| InChI | InChI=1S/C14H20N2/c1-2-3-9-14-15-10-11-16(14)12-13-7-5-4-6-8-13/h4-8H,2-3,9-12H2,1H3 |
| InChIKey | FJQXJLHWFRNMJH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzyl-2-butyl-4,5-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2-butyl-4,5-dihydroimidazole?
The IUPAC name of 1-benzyl-2-butyl-4,5-dihydroimidazole (CID 15927213) is 1-benzyl-2-butyl-4,5-dihydroimidazole.
What is the SMILES notation for 1-benzyl-2-butyl-4,5-dihydroimidazole?
The canonical SMILES for 1-benzyl-2-butyl-4,5-dihydroimidazole is CCCCC1=NCCN1Cc1ccccc1.
What is the InChIKey of 1-benzyl-2-butyl-4,5-dihydroimidazole?
The InChIKey is FJQXJLHWFRNMJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2/c1-2-3-9-14-15-10-11-16(14)12-13-7-5-4-6-8-13/h4-8H,2-3,9-12H2,1H3.
What are the key properties of 1-benzyl-2-butyl-4,5-dihydroimidazole?
1-benzyl-2-butyl-4,5-dihydroimidazole has a molecular weight of 216.33 g/mol, XLogP of 3.09, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2-butyl-4,5-dihydroimidazole is sourced from PubChem (CID 15927213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).