C64H69O5P — CID 159272430
[4-[(4-methoxyphenyl)-(5-oxo-6H-phosphanthridin-5-yl)-[4-(2,4,6-trimethylphenoxy)phenyl]methyl]phenyl] acetate;1,2,3,5-tetramethylbenzene;tricyclo[5.2.1.02,6]decane (PubChem CID 159272430) has the molecular formula C64H69O5P and a molecular weight of 949.22 g/mol. Its IUPAC name is [4-[(4-methoxyphenyl)-(5-oxo-6H-phosphanthridin-5-yl)-[4-(2,4,6-trimethylphenoxy)phenyl]methyl]phenyl] acetate;1,2,3,5-tetramethylbenzene;tricyclo[5.2.1.02,6]decane.
| Compound Name | [4-[(4-methoxyphenyl)-(5-oxo-6H-phosphanthridin-5-yl)-[4-(2,4,6-trimethylphenoxy)phenyl]methyl]phenyl] acetate;1,2,3,5-tetramethylbenzene;tricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 159272430 |
| Molecular Formula | C64H69O5P |
| Molecular Weight | 949.22 g/mol |
| Exact Mass | 948.49 |
| IUPAC Name | [4-[(4-methoxyphenyl)-(5-oxo-6H-phosphanthridin-5-yl)-[4-(2,4,6-trimethylphenoxy)phenyl]methyl]phenyl] acetate;1,2,3,5-tetramethylbenzene;tricyclo[5.2.1.02,6]decane |
| SMILES | C1CC2C3CCC(C3)C2C1.COc1ccc(C(c2ccc(OC(C)=O)cc2)(c2ccc(Oc3c(C)cc(C)cc3C)cc2)P2(=O)Cc3ccccc3-c3ccccc32)cc1.Cc1cc(C)c(C)c(C)c1 |
| InChI | InChI=1S/C44H39O5P.C10H16.C10H14/c1-29-26-30(2)43(31(3)27-29)49-39-24-18-36(19-25-39)44(34-14-20-37(47-5)21-15-34,35-16-22-38(23-17-35)48-32(4)45)50(46)28-33-10-6-7-11-40(33)41-12-8-9-13-42(41)50;1-2-9-7-4-5-8(6-7)10(9)3-1;1-7-5-8(2)10(4)9(3)6-7/h6-27H,28H2,1-5H3;7-10H,1-6H2;5-6H,1-4H3 |
| InChIKey | KXWONWZZFWDRCD-UHFFFAOYSA-N |
| XLogP | 16.25 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.22 |
| LogP ≤ 5 | 16.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|