C24H45NO6S2 — CID 159273211
9-[2-(2-ethoxyethoxy)ethyldisulfanyl]-1-[(2R,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]-9-methyldecane-1,6-dione (PubChem CID 159273211) has the molecular formula C24H45NO6S2 and a molecular weight of 507.76 g/mol. Its IUPAC name is 9-[2-(2-ethoxyethoxy)ethyldisulfanyl]-1-[(2R,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]-9-methyldecane-1,6-dione.
| Compound Name | 9-[2-(2-ethoxyethoxy)ethyldisulfanyl]-1-[(2R,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]-9-methyldecane-1,6-dione |
|---|---|
| PubChem CID | 159273211 |
| Molecular Formula | C24H45NO6S2 |
| Molecular Weight | 507.76 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | 9-[2-(2-ethoxyethoxy)ethyldisulfanyl]-1-[(2R,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]-9-methyldecane-1,6-dione |
| SMILES | CCOCCOCCSSC(C)(C)CCC(=O)CCCCC(=O)N1C[C@@H](OC)C[C@@H]1COC |
| InChI | InChI=1S/C24H45NO6S2/c1-6-30-13-14-31-15-16-32-33-24(2,3)12-11-21(26)9-7-8-10-23(27)25-18-22(29-5)17-20(25)19-28-4/h20,22H,6-19H2,1-5H3/t20-,22+/m1/s1 |
| InChIKey | JWOSDTNVDJKJSX-IRLDBZIGSA-N |
| XLogP | 4.37 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.76 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|