C20H21FN4O2S — CID 159273229
N-[[4-[(3E)-1,1-diaminopenta-1,3-dien-3-yl]oxy-3-fluorophenyl]carbamothioyl]-2-phenylacetamide (PubChem CID 159273229) has the molecular formula C20H21FN4O2S and a molecular weight of 400.48 g/mol. Its IUPAC name is N-[[4-[(3E)-1,1-diaminopenta-1,3-dien-3-yl]oxy-3-fluorophenyl]carbamothioyl]-2-phenylacetamide.
| Compound Name | N-[[4-[(3E)-1,1-diaminopenta-1,3-dien-3-yl]oxy-3-fluorophenyl]carbamothioyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 159273229 |
| Molecular Formula | C20H21FN4O2S |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | N-[[4-[(3E)-1,1-diaminopenta-1,3-dien-3-yl]oxy-3-fluorophenyl]carbamothioyl]-2-phenylacetamide |
| SMILES | C/C=C(\C=C(N)N)Oc1ccc(NC(=S)NC(=O)Cc2ccccc2)cc1F |
| InChI | InChI=1S/C20H21FN4O2S/c1-2-15(12-18(22)23)27-17-9-8-14(11-16(17)21)24-20(28)25-19(26)10-13-6-4-3-5-7-13/h2-9,11-12H,10,22-23H2,1H3,(H2,24,25,26,28)/b15-2+ |
| InChIKey | KXZAXMAVJOXIKP-RSSMCMFDSA-N |
| XLogP | 2.92 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|