About (3-chloro-1,2-oxazol-5-yl)methanol
(3-chloro-1,2-oxazol-5-yl)methanol (PubChem CID 159274465) has the molecular formula C8H8Cl2N2O4
and a molecular weight of 267.07 g/mol. Its IUPAC name is (3-chloro-1,2-oxazol-5-yl)methanol.
Molecular Properties
| Compound Name | (3-chloro-1,2-oxazol-5-yl)methanol |
| PubChem CID | 159274465 |
| Molecular Formula | C8H8Cl2N2O4 |
| Molecular Weight | 267.07 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | (3-chloro-1,2-oxazol-5-yl)methanol |
| SMILES | OCc1cc(Cl)no1.OCc1cc(Cl)no1 |
| InChI | InChI=1S/2C4H4ClNO2/c2*5-4-1-3(2-7)8-6-4/h2*1,7H,2H2 |
| InChIKey | KYCWVOUDYZJUBJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 92.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.07 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-chloro-1,2-oxazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chloro-1,2-oxazol-5-yl)methanol?
The IUPAC name of (3-chloro-1,2-oxazol-5-yl)methanol (CID 159274465) is (3-chloro-1,2-oxazol-5-yl)methanol.
What is the SMILES notation for (3-chloro-1,2-oxazol-5-yl)methanol?
The canonical SMILES for (3-chloro-1,2-oxazol-5-yl)methanol is OCc1cc(Cl)no1.OCc1cc(Cl)no1.
What is the InChIKey of (3-chloro-1,2-oxazol-5-yl)methanol?
The InChIKey is KYCWVOUDYZJUBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H4ClNO2/c2*5-4-1-3(2-7)8-6-4/h2*1,7H,2H2.
What are the key properties of (3-chloro-1,2-oxazol-5-yl)methanol?
(3-chloro-1,2-oxazol-5-yl)methanol has a molecular weight of 267.07 g/mol, XLogP of 1.64, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chloro-1,2-oxazol-5-yl)methanol is sourced from PubChem (CID 159274465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).