C22H24N4O2S — CID 159275366
(1-thieno[3,2-d]pyrimidin-4-ylpyrrolidin-3-yl) 2-(4-pyrrolidin-1-ylphenyl)acetate (PubChem CID 159275366) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is (1-thieno[3,2-d]pyrimidin-4-ylpyrrolidin-3-yl) 2-(4-pyrrolidin-1-ylphenyl)acetate.
| Compound Name | (1-thieno[3,2-d]pyrimidin-4-ylpyrrolidin-3-yl) 2-(4-pyrrolidin-1-ylphenyl)acetate |
|---|---|
| PubChem CID | 159275366 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | (1-thieno[3,2-d]pyrimidin-4-ylpyrrolidin-3-yl) 2-(4-pyrrolidin-1-ylphenyl)acetate |
| SMILES | O=C(Cc1ccc(N2CCCC2)cc1)OC1CCN(c2ncnc3ccsc23)C1 |
| InChI | InChI=1S/C22H24N4O2S/c27-20(13-16-3-5-17(6-4-16)25-9-1-2-10-25)28-18-7-11-26(14-18)22-21-19(8-12-29-21)23-15-24-22/h3-6,8,12,15,18H,1-2,7,9-11,13-14H2 |
| InChIKey | WBOCEGGBVQUNPZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|