About 1-tert-butyl-3,5-dimethylpyrazole;methane
1-tert-butyl-3,5-dimethylpyrazole;methane (PubChem CID 159275422) has the molecular formula C11H24N2
and a molecular weight of 184.33 g/mol. Its IUPAC name is 1-tert-butyl-3,5-dimethylpyrazole;methane.
Molecular Properties
| Compound Name | 1-tert-butyl-3,5-dimethylpyrazole;methane |
| PubChem CID | 159275422 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 1-tert-butyl-3,5-dimethylpyrazole;methane |
| SMILES | C.C.Cc1cc(C)n(C(C)(C)C)n1 |
| InChI | InChI=1S/C9H16N2.2CH4/c1-7-6-8(2)11(10-7)9(3,4)5;;/h6H,1-5H3;2*1H4 |
| InChIKey | KYFZTFQTNMIMLD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butyl-3,5-dimethylpyrazole;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3,5-dimethylpyrazole;methane?
The IUPAC name of 1-tert-butyl-3,5-dimethylpyrazole;methane (CID 159275422) is 1-tert-butyl-3,5-dimethylpyrazole;methane.
What is the SMILES notation for 1-tert-butyl-3,5-dimethylpyrazole;methane?
The canonical SMILES for 1-tert-butyl-3,5-dimethylpyrazole;methane is C.C.Cc1cc(C)n(C(C)(C)C)n1.
What is the InChIKey of 1-tert-butyl-3,5-dimethylpyrazole;methane?
The InChIKey is KYFZTFQTNMIMLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2.2CH4/c1-7-6-8(2)11(10-7)9(3,4)5;;/h6H,1-5H3;2*1H4.
What are the key properties of 1-tert-butyl-3,5-dimethylpyrazole;methane?
1-tert-butyl-3,5-dimethylpyrazole;methane has a molecular weight of 184.33 g/mol, XLogP of 3.53, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3,5-dimethylpyrazole;methane is sourced from PubChem (CID 159275422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).