About 4-(1,2-dibromoethyl)-6-hydroxy-2-(4-hydroxyphenyl)isoquinolin-1-one
4-(1,2-dibromoethyl)-6-hydroxy-2-(4-hydroxyphenyl)isoquinolin-1-one (PubChem CID 159276028) has the molecular formula C34H26Br4N2O6
and a molecular weight of 878.21 g/mol. Its IUPAC name is 4-(1,2-dibromoethyl)-6-hydroxy-2-(4-hydroxyphenyl)isoquinolin-1-one.
Molecular Properties
| Compound Name | 4-(1,2-dibromoethyl)-6-hydroxy-2-(4-hydroxyphenyl)isoquinolin-1-one |
| PubChem CID | 159276028 |
| Molecular Formula | C34H26Br4N2O6 |
| Molecular Weight | 878.21 g/mol |
| Exact Mass | 873.85 |
| IUPAC Name | 4-(1,2-dibromoethyl)-6-hydroxy-2-(4-hydroxyphenyl)isoquinolin-1-one |
| SMILES | O=c1c2ccc(O)cc2c(C(Br)CBr)cn1-c1ccc(O)cc1.O=c1c2ccc(O)cc2c(C(Br)CBr)cn1-c1ccc(O)cc1 |
| InChI | InChI=1S/2C17H13Br2NO3/c2*18-8-16(19)15-9-20(10-1-3-11(21)4-2-10)17(23)13-6-5-12(22)7-14(13)15/h2*1-7,9,16,21-22H,8H2 |
| InChIKey | KYHZJWAVRBSUJB-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 124.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 878.21 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,2-dibromoethyl)-6-hydroxy-2-(4-hydroxyphenyl)isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,2-dibromoethyl)-6-hydroxy-2-(4-hydroxyphenyl)isoquinolin-1-one?
The IUPAC name of 4-(1,2-dibromoethyl)-6-hydroxy-2-(4-hydroxyphenyl)isoquinolin-1-one (CID 159276028) is 4-(1,2-dibromoethyl)-6-hydroxy-2-(4-hydroxyphenyl)isoquinolin-1-one.
What is the SMILES notation for 4-(1,2-dibromoethyl)-6-hydroxy-2-(4-hydroxyphenyl)isoquinolin-1-one?
The canonical SMILES for 4-(1,2-dibromoethyl)-6-hydroxy-2-(4-hydroxyphenyl)isoquinolin-1-one is O=c1c2ccc(O)cc2c(C(Br)CBr)cn1-c1ccc(O)cc1.O=c1c2ccc(O)cc2c(C(Br)CBr)cn1-c1ccc(O)cc1.
What is the InChIKey of 4-(1,2-dibromoethyl)-6-hydroxy-2-(4-hydroxyphenyl)isoquinolin-1-one?
The InChIKey is KYHZJWAVRBSUJB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C17H13Br2NO3/c2*18-8-16(19)15-9-20(10-1-3-11(21)4-2-10)17(23)13-6-5-12(22)7-14(13)15/h2*1-7,9,16,21-22H,8H2.
What are the key properties of 4-(1,2-dibromoethyl)-6-hydroxy-2-(4-hydroxyphenyl)isoquinolin-1-one?
4-(1,2-dibromoethyl)-6-hydroxy-2-(4-hydroxyphenyl)isoquinolin-1-one has a molecular weight of 878.21 g/mol, XLogP of 8.47, 6 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2-dibromoethyl)-6-hydroxy-2-(4-hydroxyphenyl)isoquinolin-1-one is sourced from PubChem (CID 159276028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).