C49H29N7O — CID 159276431
2-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-4-yl]-4-[4-(4-isocyanophenyl)phenyl]-6-phenyl-1,3,5-triazine (PubChem CID 159276431) has the molecular formula C49H29N7O and a molecular weight of 731.82 g/mol. Its IUPAC name is 2-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-4-yl]-4-[4-(4-isocyanophenyl)phenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-4-yl]-4-[4-(4-isocyanophenyl)phenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 159276431 |
| Molecular Formula | C49H29N7O |
| Molecular Weight | 731.82 g/mol |
| Exact Mass | 731.24 |
| IUPAC Name | 2-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-4-yl]-4-[4-(4-isocyanophenyl)phenyl]-6-phenyl-1,3,5-triazine |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4cccc5c4oc4cccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c45)n3)cc2)cc1 |
| InChI | InChI=1S/C49H29N7O/c1-50-37-29-27-32(28-30-37)31-23-25-36(26-24-31)47-52-46(35-17-9-4-10-18-35)55-49(56-47)40-21-11-19-38-42-39(20-12-22-41(42)57-43(38)40)48-53-44(33-13-5-2-6-14-33)51-45(54-48)34-15-7-3-8-16-34/h2-30H |
| InChIKey | GVTDRHHGZKYTBE-UHFFFAOYSA-N |
| XLogP | 12.18 |
| TPSA | 94.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.82 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|