C21H37N3O5 — CID 15927644
(2S)-1-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-6-piperidin-4-ylhexan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 15927644) has the molecular formula C21H37N3O5 and a molecular weight of 411.54 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-6-piperidin-4-ylhexan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-6-piperidin-4-ylhexan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 15927644 |
| Molecular Formula | C21H37N3O5 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.27 |
| IUPAC Name | (2S)-1-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-6-piperidin-4-ylhexan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCOC(=O)[C@H](CCCCC1CCNCC1)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C21H37N3O5/c1-3-29-21(28)17(8-5-4-7-16-10-12-22-13-11-16)23-15(2)19(25)24-14-6-9-18(24)20(26)27/h15-18,22-23H,3-14H2,1-2H3,(H,26,27)/t15-,17-,18-/m0/s1 |
| InChIKey | VOZHNBSRXOGQLD-SZMVWBNQSA-N |
| XLogP | 1.53 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|